C27H29F2N3O4S2 — CID 87325581
(E)-N-(5-butoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)-2-(4-cyclopropylsulfonylphenyl)-3-(3,4-difluorocyclopentyl)prop-2-enamide (PubChem CID 87325581) has the molecular formula C27H29F2N3O4S2 and a molecular weight of 561.68 g/mol. Its IUPAC name is (E)-N-(5-butoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)-2-(4-cyclopropylsulfonylphenyl)-3-(3,4-difluorocyclopentyl)prop-2-enamide.
| Compound Name | (E)-N-(5-butoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)-2-(4-cyclopropylsulfonylphenyl)-3-(3,4-difluorocyclopentyl)prop-2-enamide |
|---|---|
| PubChem CID | 87325581 |
| Molecular Formula | C27H29F2N3O4S2 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | (E)-N-(5-butoxy-[1,3]thiazolo[5,4-b]pyridin-2-yl)-2-(4-cyclopropylsulfonylphenyl)-3-(3,4-difluorocyclopentyl)prop-2-enamide |
| SMILES | CCCCOc1ccc2nc(NC(=O)/C(=C/C3CC(F)C(F)C3)c3ccc(S(=O)(=O)C4CC4)cc3)sc2n1 |
| InChI | InChI=1S/C27H29F2N3O4S2/c1-2-3-12-36-24-11-10-23-26(31-24)37-27(30-23)32-25(33)20(13-16-14-21(28)22(29)15-16)17-4-6-18(7-5-17)38(34,35)19-8-9-19/h4-7,10-11,13,16,19,21-22H,2-3,8-9,12,14-15H2,1H3,(H,30,32,33)/b20-13+ |
| InChIKey | ZANPIJQOWFASKH-DEDYPNTBSA-N |
| XLogP | 5.91 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|