C19H22F2O4S — CID 67249712
ethyl (E)-2-(4-cyclopropylsulfonylphenyl)-3-(3,4-difluorocyclopentyl)prop-2-enoate (PubChem CID 67249712) has the molecular formula C19H22F2O4S and a molecular weight of 384.44 g/mol. Its IUPAC name is ethyl (E)-2-(4-cyclopropylsulfonylphenyl)-3-(3,4-difluorocyclopentyl)prop-2-enoate.
| Compound Name | ethyl (E)-2-(4-cyclopropylsulfonylphenyl)-3-(3,4-difluorocyclopentyl)prop-2-enoate |
|---|---|
| PubChem CID | 67249712 |
| Molecular Formula | C19H22F2O4S |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | ethyl (E)-2-(4-cyclopropylsulfonylphenyl)-3-(3,4-difluorocyclopentyl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/C1CC(F)C(F)C1)c1ccc(S(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C19H22F2O4S/c1-2-25-19(22)16(9-12-10-17(20)18(21)11-12)13-3-5-14(6-4-13)26(23,24)15-7-8-15/h3-6,9,12,15,17-18H,2,7-8,10-11H2,1H3/b16-9+ |
| InChIKey | QLVOBJSQMITHPA-CXUHLZMHSA-N |
| XLogP | 3.66 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|