C24H27F2N3O4S — CID 66880061
(E)-2-(4-cyclopropylsulfonylphenyl)-3-(3,4-difluorocyclopentyl)-N-(5-propoxypyrazin-2-yl)prop-2-enamide (PubChem CID 66880061) has the molecular formula C24H27F2N3O4S and a molecular weight of 491.56 g/mol. Its IUPAC name is (E)-2-(4-cyclopropylsulfonylphenyl)-3-(3,4-difluorocyclopentyl)-N-(5-propoxypyrazin-2-yl)prop-2-enamide.
| Compound Name | (E)-2-(4-cyclopropylsulfonylphenyl)-3-(3,4-difluorocyclopentyl)-N-(5-propoxypyrazin-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 66880061 |
| Molecular Formula | C24H27F2N3O4S |
| Molecular Weight | 491.56 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | (E)-2-(4-cyclopropylsulfonylphenyl)-3-(3,4-difluorocyclopentyl)-N-(5-propoxypyrazin-2-yl)prop-2-enamide |
| SMILES | CCCOc1cnc(NC(=O)/C(=C/C2CC(F)C(F)C2)c2ccc(S(=O)(=O)C3CC3)cc2)cn1 |
| InChI | InChI=1S/C24H27F2N3O4S/c1-2-9-33-23-14-27-22(13-28-23)29-24(30)19(10-15-11-20(25)21(26)12-15)16-3-5-17(6-4-16)34(31,32)18-7-8-18/h3-6,10,13-15,18,20-21H,2,7-9,11-12H2,1H3,(H,27,29,30)/b19-10+ |
| InChIKey | WUTCJVQHSZXMKX-VXLYETTFSA-N |
| XLogP | 4.31 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|