C25H29F2N3O5S — CID 66880429
(E)-2-(4-cyclopropylsulfonylphenyl)-3-(3,4-difluorocyclopentyl)-N-[5-(2-ethoxyethoxy)pyrazin-2-yl]prop-2-enamide (PubChem CID 66880429) has the molecular formula C25H29F2N3O5S and a molecular weight of 521.59 g/mol. Its IUPAC name is (E)-2-(4-cyclopropylsulfonylphenyl)-3-(3,4-difluorocyclopentyl)-N-[5-(2-ethoxyethoxy)pyrazin-2-yl]prop-2-enamide.
| Compound Name | (E)-2-(4-cyclopropylsulfonylphenyl)-3-(3,4-difluorocyclopentyl)-N-[5-(2-ethoxyethoxy)pyrazin-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 66880429 |
| Molecular Formula | C25H29F2N3O5S |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | (E)-2-(4-cyclopropylsulfonylphenyl)-3-(3,4-difluorocyclopentyl)-N-[5-(2-ethoxyethoxy)pyrazin-2-yl]prop-2-enamide |
| SMILES | CCOCCOc1cnc(NC(=O)/C(=C/C2CC(F)C(F)C2)c2ccc(S(=O)(=O)C3CC3)cc2)cn1 |
| InChI | InChI=1S/C25H29F2N3O5S/c1-2-34-9-10-35-24-15-28-23(14-29-24)30-25(31)20(11-16-12-21(26)22(27)13-16)17-3-5-18(6-4-17)36(32,33)19-7-8-19/h3-6,11,14-16,19,21-22H,2,7-10,12-13H2,1H3,(H,28,30,31)/b20-11+ |
| InChIKey | UOUPVBLGTQYYFY-RGVLZGJSSA-N |
| XLogP | 3.94 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|