C17H18F2O4S — CID 123149041
2-(4-cyclopropylsulfonylphenyl)-3-[(3R,4S)-3,4-difluorocyclopentyl]prop-2-enoic acid (PubChem CID 123149041) has the molecular formula C17H18F2O4S and a molecular weight of 356.39 g/mol. Its IUPAC name is 2-(4-cyclopropylsulfonylphenyl)-3-[(3R,4S)-3,4-difluorocyclopentyl]prop-2-enoic acid.
| Compound Name | 2-(4-cyclopropylsulfonylphenyl)-3-[(3R,4S)-3,4-difluorocyclopentyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123149041 |
| Molecular Formula | C17H18F2O4S |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 2-(4-cyclopropylsulfonylphenyl)-3-[(3R,4S)-3,4-difluorocyclopentyl]prop-2-enoic acid |
| SMILES | O=C(O)C(=CC1C[C@@H](F)[C@@H](F)C1)c1ccc(S(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C17H18F2O4S/c18-15-8-10(9-16(15)19)7-14(17(20)21)11-1-3-12(4-2-11)24(22,23)13-5-6-13/h1-4,7,10,13,15-16H,5-6,8-9H2,(H,20,21)/t10?,15-,16+ |
| InChIKey | SXWYWJVOSJTWFG-QEPHCTRTSA-N |
| XLogP | 3.18 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|