C17H18F2O3S — CID 88939780
(E)-2-(4-cyclopropylsulfonylphenyl)-3-[(3S,4R)-3,4-difluorocyclopentyl]prop-2-enal (PubChem CID 88939780) has the molecular formula C17H18F2O3S and a molecular weight of 340.39 g/mol. Its IUPAC name is (E)-2-(4-cyclopropylsulfonylphenyl)-3-[(3S,4R)-3,4-difluorocyclopentyl]prop-2-enal.
| Compound Name | (E)-2-(4-cyclopropylsulfonylphenyl)-3-[(3S,4R)-3,4-difluorocyclopentyl]prop-2-enal |
|---|---|
| PubChem CID | 88939780 |
| Molecular Formula | C17H18F2O3S |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | (E)-2-(4-cyclopropylsulfonylphenyl)-3-[(3S,4R)-3,4-difluorocyclopentyl]prop-2-enal |
| SMILES | O=C/C(=C/C1C[C@@H](F)[C@@H](F)C1)c1ccc(S(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C17H18F2O3S/c18-16-8-11(9-17(16)19)7-13(10-20)12-1-3-14(4-2-12)23(21,22)15-5-6-15/h1-4,7,10-11,15-17H,5-6,8-9H2/b13-7-/t11?,16-,17+ |
| InChIKey | RQCBYMQDNOTUSX-NHWOLNGOSA-N |
| XLogP | 3.29 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|