C23H25F2N3O3S — CID 123514560
2-(4-cyclopropylsulfonylphenyl)-3-[(3S,4R)-3,4-difluorocyclopentyl]-N-(5-ethylpyrazin-2-yl)prop-2-enamide (PubChem CID 123514560) has the molecular formula C23H25F2N3O3S and a molecular weight of 461.53 g/mol. Its IUPAC name is 2-(4-cyclopropylsulfonylphenyl)-3-[(3S,4R)-3,4-difluorocyclopentyl]-N-(5-ethylpyrazin-2-yl)prop-2-enamide.
| Compound Name | 2-(4-cyclopropylsulfonylphenyl)-3-[(3S,4R)-3,4-difluorocyclopentyl]-N-(5-ethylpyrazin-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 123514560 |
| Molecular Formula | C23H25F2N3O3S |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 2-(4-cyclopropylsulfonylphenyl)-3-[(3S,4R)-3,4-difluorocyclopentyl]-N-(5-ethylpyrazin-2-yl)prop-2-enamide |
| SMILES | CCc1cnc(NC(=O)C(=CC2C[C@@H](F)[C@@H](F)C2)c2ccc(S(=O)(=O)C3CC3)cc2)cn1 |
| InChI | InChI=1S/C23H25F2N3O3S/c1-2-16-12-27-22(13-26-16)28-23(29)19(9-14-10-20(24)21(25)11-14)15-3-5-17(6-4-15)32(30,31)18-7-8-18/h3-6,9,12-14,18,20-21H,2,7-8,10-11H2,1H3,(H,27,28,29)/t14?,20-,21+ |
| InChIKey | QVDOXIDLXQQARW-QCWXFEJRSA-N |
| XLogP | 4.08 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|