C21H23F2N3O3S — CID 67251225
(E)-3-[(3S,4R)-3,4-difluorocyclopentyl]-2-(4-ethylsulfonylphenyl)-N-(5-methylpyrazin-2-yl)prop-2-enamide (PubChem CID 67251225) has the molecular formula C21H23F2N3O3S and a molecular weight of 435.50 g/mol. Its IUPAC name is (E)-3-[(3S,4R)-3,4-difluorocyclopentyl]-2-(4-ethylsulfonylphenyl)-N-(5-methylpyrazin-2-yl)prop-2-enamide.
| Compound Name | (E)-3-[(3S,4R)-3,4-difluorocyclopentyl]-2-(4-ethylsulfonylphenyl)-N-(5-methylpyrazin-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 67251225 |
| Molecular Formula | C21H23F2N3O3S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | (E)-3-[(3S,4R)-3,4-difluorocyclopentyl]-2-(4-ethylsulfonylphenyl)-N-(5-methylpyrazin-2-yl)prop-2-enamide |
| SMILES | CCS(=O)(=O)c1ccc(/C(=C\C2C[C@@H](F)[C@@H](F)C2)C(=O)Nc2cnc(C)cn2)cc1 |
| InChI | InChI=1S/C21H23F2N3O3S/c1-3-30(28,29)16-6-4-15(5-7-16)17(8-14-9-18(22)19(23)10-14)21(27)26-20-12-24-13(2)11-25-20/h4-8,11-12,14,18-19H,3,9-10H2,1-2H3,(H,25,26,27)/b17-8+/t14?,18-,19+ |
| InChIKey | WDGULELCFQPAMK-IZAFWIQRSA-N |
| XLogP | 3.69 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|