C20H22F2N2O4S2 — CID 87189164
(E)-3-(3,4-difluorocyclopentyl)-N-[4-(2-hydroxyethyl)-1,3-thiazol-2-yl]-2-(4-methylsulfonylphenyl)prop-2-enamide (PubChem CID 87189164) has the molecular formula C20H22F2N2O4S2 and a molecular weight of 456.54 g/mol. Its IUPAC name is (E)-3-(3,4-difluorocyclopentyl)-N-[4-(2-hydroxyethyl)-1,3-thiazol-2-yl]-2-(4-methylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-difluorocyclopentyl)-N-[4-(2-hydroxyethyl)-1,3-thiazol-2-yl]-2-(4-methylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 87189164 |
| Molecular Formula | C20H22F2N2O4S2 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | (E)-3-(3,4-difluorocyclopentyl)-N-[4-(2-hydroxyethyl)-1,3-thiazol-2-yl]-2-(4-methylsulfonylphenyl)prop-2-enamide |
| SMILES | CS(=O)(=O)c1ccc(/C(=C\C2CC(F)C(F)C2)C(=O)Nc2nc(CCO)cs2)cc1 |
| InChI | InChI=1S/C20H22F2N2O4S2/c1-30(27,28)15-4-2-13(3-5-15)16(8-12-9-17(21)18(22)10-12)19(26)24-20-23-14(6-7-25)11-29-20/h2-5,8,11-12,17-18,25H,6-7,9-10H2,1H3,(H,23,24,26)/b16-8+ |
| InChIKey | XSCNYTOAFORDCB-LZYBPNLTSA-N |
| XLogP | 3.19 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|