C19H19F2NO3S2 — CID 58328492
(E)-4-[(3S,4R)-3,4-difluorocyclopentyl]-3-(4-methylsulfonylphenyl)-1-(1,3-thiazol-2-yl)but-3-en-2-one (PubChem CID 58328492) has the molecular formula C19H19F2NO3S2 and a molecular weight of 411.50 g/mol. Its IUPAC name is (E)-4-[(3S,4R)-3,4-difluorocyclopentyl]-3-(4-methylsulfonylphenyl)-1-(1,3-thiazol-2-yl)but-3-en-2-one.
| Compound Name | (E)-4-[(3S,4R)-3,4-difluorocyclopentyl]-3-(4-methylsulfonylphenyl)-1-(1,3-thiazol-2-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 58328492 |
| Molecular Formula | C19H19F2NO3S2 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | (E)-4-[(3S,4R)-3,4-difluorocyclopentyl]-3-(4-methylsulfonylphenyl)-1-(1,3-thiazol-2-yl)but-3-en-2-one |
| SMILES | CS(=O)(=O)c1ccc(/C(=C\C2C[C@@H](F)[C@@H](F)C2)C(=O)Cc2nccs2)cc1 |
| InChI | InChI=1S/C19H19F2NO3S2/c1-27(24,25)14-4-2-13(3-5-14)15(8-12-9-16(20)17(21)10-12)18(23)11-19-22-6-7-26-19/h2-8,12,16-17H,9-11H2,1H3/b15-8+/t12?,16-,17+ |
| InChIKey | ZOKLJYWQPIQCTM-QTIWUYITSA-N |
| XLogP | 3.83 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|