C23H26F2N2O5S2 — CID 87325203
(E)-3-[(3S,4R)-3,4-difluorocyclopentyl]-N-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1,3-thiazol-2-yl]-2-(4-methylsulfonylphenyl)prop-2-enamide (PubChem CID 87325203) has the molecular formula C23H26F2N2O5S2 and a molecular weight of 512.60 g/mol. Its IUPAC name is (E)-3-[(3S,4R)-3,4-difluorocyclopentyl]-N-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1,3-thiazol-2-yl]-2-(4-methylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[(3S,4R)-3,4-difluorocyclopentyl]-N-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1,3-thiazol-2-yl]-2-(4-methylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 87325203 |
| Molecular Formula | C23H26F2N2O5S2 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | (E)-3-[(3S,4R)-3,4-difluorocyclopentyl]-N-[4-(2,2-dimethyl-1,3-dioxolan-4-yl)-1,3-thiazol-2-yl]-2-(4-methylsulfonylphenyl)prop-2-enamide |
| SMILES | CC1(C)OCC(c2csc(NC(=O)/C(=C/C3C[C@@H](F)[C@@H](F)C3)c3ccc(S(C)(=O)=O)cc3)n2)O1 |
| InChI | InChI=1S/C23H26F2N2O5S2/c1-23(2)31-11-20(32-23)19-12-33-22(26-19)27-21(28)16(8-13-9-17(24)18(25)10-13)14-4-6-15(7-5-14)34(3,29)30/h4-8,12-13,17-18,20H,9-11H2,1-3H3,(H,26,27,28)/b16-8+/t13?,17-,18+,20? |
| InChIKey | GVBNQJPOIAVXOO-AHSJPSQNSA-N |
| XLogP | 4.48 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|