C22H27F2N3O4S — CID 67250666
(E)-3-(3,4-difluorocyclopentyl)-N-[1-(2-hydroxy-2-methylpropyl)pyrazol-3-yl]-2-(4-methylsulfonylphenyl)prop-2-enamide (PubChem CID 67250666) has the molecular formula C22H27F2N3O4S and a molecular weight of 467.54 g/mol. Its IUPAC name is (E)-3-(3,4-difluorocyclopentyl)-N-[1-(2-hydroxy-2-methylpropyl)pyrazol-3-yl]-2-(4-methylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-difluorocyclopentyl)-N-[1-(2-hydroxy-2-methylpropyl)pyrazol-3-yl]-2-(4-methylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 67250666 |
| Molecular Formula | C22H27F2N3O4S |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | (E)-3-(3,4-difluorocyclopentyl)-N-[1-(2-hydroxy-2-methylpropyl)pyrazol-3-yl]-2-(4-methylsulfonylphenyl)prop-2-enamide |
| SMILES | CC(C)(O)Cn1ccc(NC(=O)/C(=C/C2CC(F)C(F)C2)c2ccc(S(C)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C22H27F2N3O4S/c1-22(2,29)13-27-9-8-20(26-27)25-21(28)17(10-14-11-18(23)19(24)12-14)15-4-6-16(7-5-15)32(3,30)31/h4-10,14,18-19,29H,11-13H2,1-3H3,(H,25,26,28)/b17-10+ |
| InChIKey | QEKNOPOQSDIUCK-LICLKQGHSA-N |
| XLogP | 3.17 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|