C27H34N2O5S2 — CID 76674886
3-cyclopentyl-2-(4-cyclopropylsulfonylphenyl)-N-[4-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 76674886) has the molecular formula C27H34N2O5S2 and a molecular weight of 530.71 g/mol. Its IUPAC name is 3-cyclopentyl-2-(4-cyclopropylsulfonylphenyl)-N-[4-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | 3-cyclopentyl-2-(4-cyclopropylsulfonylphenyl)-N-[4-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 76674886 |
| Molecular Formula | C27H34N2O5S2 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 3-cyclopentyl-2-(4-cyclopropylsulfonylphenyl)-N-[4-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | CC1(C)OC(c2csc(NC(=O)C(=CC3CCCC3)c3ccc(S(=O)(=O)C4CC4)cc3)n2)C(C)(C)O1 |
| InChI | InChI=1S/C27H34N2O5S2/c1-26(2)23(33-27(3,4)34-26)22-16-35-25(28-22)29-24(30)21(15-17-7-5-6-8-17)18-9-11-19(12-10-18)36(31,32)20-13-14-20/h9-12,15-17,20,23H,5-8,13-14H2,1-4H3,(H,28,29,30) |
| InChIKey | JHPAKCQZLIYKID-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|