C17H20N4OS — CID 10359163
(E)-3-cyclopentyl-2-[6-(methylamino)-3-pyridinyl]-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 10359163) has the molecular formula C17H20N4OS and a molecular weight of 328.44 g/mol. Its IUPAC name is (E)-3-cyclopentyl-2-[6-(methylamino)-3-pyridinyl]-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-cyclopentyl-2-[6-(methylamino)-3-pyridinyl]-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 10359163 |
| Molecular Formula | C17H20N4OS |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (E)-3-cyclopentyl-2-[6-(methylamino)-3-pyridinyl]-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | CNc1ccc(/C(=C\C2CCCC2)C(=O)Nc2nccs2)cn1 |
| InChI | InChI=1S/C17H20N4OS/c1-18-15-7-6-13(11-20-15)14(10-12-4-2-3-5-12)16(22)21-17-19-8-9-23-17/h6-12H,2-5H2,1H3,(H,18,20)(H,19,21,22)/b14-10+ |
| InChIKey | HNQOLQZPMYOVNH-GXDHUFHOSA-N |
| XLogP | 3.79 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|