C19H23N3O3S2 — CID 142933322
(E)-3-cyclopentyl-2-(6-ethylsulfonyl-3-pyridinyl)-N-(5-methyl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 142933322) has the molecular formula C19H23N3O3S2 and a molecular weight of 405.55 g/mol. Its IUPAC name is (E)-3-cyclopentyl-2-(6-ethylsulfonyl-3-pyridinyl)-N-(5-methyl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-cyclopentyl-2-(6-ethylsulfonyl-3-pyridinyl)-N-(5-methyl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 142933322 |
| Molecular Formula | C19H23N3O3S2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | (E)-3-cyclopentyl-2-(6-ethylsulfonyl-3-pyridinyl)-N-(5-methyl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | CCS(=O)(=O)c1ccc(/C(=C\C2CCCC2)C(=O)Nc2ncc(C)s2)cn1 |
| InChI | InChI=1S/C19H23N3O3S2/c1-3-27(24,25)17-9-8-15(12-20-17)16(10-14-6-4-5-7-14)18(23)22-19-21-11-13(2)26-19/h8-12,14H,3-7H2,1-2H3,(H,21,22,23)/b16-10+ |
| InChIKey | LZRKHOHHSSXBCP-MHWRWJLKSA-N |
| XLogP | 3.85 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|