C15H21NO3S — CID 67484994
3-cyclohexyl-2-(6-methylsulfonyl-3-pyridinyl)prop-2-en-1-ol (PubChem CID 67484994) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is 3-cyclohexyl-2-(6-methylsulfonyl-3-pyridinyl)prop-2-en-1-ol.
| Compound Name | 3-cyclohexyl-2-(6-methylsulfonyl-3-pyridinyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 67484994 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 3-cyclohexyl-2-(6-methylsulfonyl-3-pyridinyl)prop-2-en-1-ol |
| SMILES | CS(=O)(=O)c1ccc(C(=CC2CCCCC2)CO)cn1 |
| InChI | InChI=1S/C15H21NO3S/c1-20(18,19)15-8-7-13(10-16-15)14(11-17)9-12-5-3-2-4-6-12/h7-10,12,17H,2-6,11H2,1H3 |
| InChIKey | OJYJRKLZQDDZPA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |