C17H18FN3O3S2 — CID 90794078
3-cyclopentyl-N-(5-fluoro-1,3-thiazol-2-yl)-2-(6-methylsulfonyl-3-pyridinyl)prop-2-enamide (PubChem CID 90794078) has the molecular formula C17H18FN3O3S2 and a molecular weight of 395.48 g/mol. Its IUPAC name is 3-cyclopentyl-N-(5-fluoro-1,3-thiazol-2-yl)-2-(6-methylsulfonyl-3-pyridinyl)prop-2-enamide.
| Compound Name | 3-cyclopentyl-N-(5-fluoro-1,3-thiazol-2-yl)-2-(6-methylsulfonyl-3-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 90794078 |
| Molecular Formula | C17H18FN3O3S2 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 3-cyclopentyl-N-(5-fluoro-1,3-thiazol-2-yl)-2-(6-methylsulfonyl-3-pyridinyl)prop-2-enamide |
| SMILES | CS(=O)(=O)c1ccc(C(=CC2CCCC2)C(=O)Nc2ncc(F)s2)cn1 |
| InChI | InChI=1S/C17H18FN3O3S2/c1-26(23,24)15-7-6-12(9-19-15)13(8-11-4-2-3-5-11)16(22)21-17-20-10-14(18)25-17/h6-11H,2-5H2,1H3,(H,20,21,22) |
| InChIKey | QPJBUFZPMUFBSA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|