C17H17Cl2N3O2S2 — CID 10477775
(E)-2-(5-chloro-6-methylsulfinyl-3-pyridinyl)-N-(5-chloro-1,3-thiazol-2-yl)-3-cyclopentylprop-2-enamide (PubChem CID 10477775) has the molecular formula C17H17Cl2N3O2S2 and a molecular weight of 430.38 g/mol. Its IUPAC name is (E)-2-(5-chloro-6-methylsulfinyl-3-pyridinyl)-N-(5-chloro-1,3-thiazol-2-yl)-3-cyclopentylprop-2-enamide.
| Compound Name | (E)-2-(5-chloro-6-methylsulfinyl-3-pyridinyl)-N-(5-chloro-1,3-thiazol-2-yl)-3-cyclopentylprop-2-enamide |
|---|---|
| PubChem CID | 10477775 |
| Molecular Formula | C17H17Cl2N3O2S2 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | (E)-2-(5-chloro-6-methylsulfinyl-3-pyridinyl)-N-(5-chloro-1,3-thiazol-2-yl)-3-cyclopentylprop-2-enamide |
| SMILES | CS(=O)c1ncc(/C(=C\C2CCCC2)C(=O)Nc2ncc(Cl)s2)cc1Cl |
| InChI | InChI=1S/C17H17Cl2N3O2S2/c1-26(24)16-13(18)7-11(8-20-16)12(6-10-4-2-3-5-10)15(23)22-17-21-9-14(19)25-17/h6-10H,2-5H2,1H3,(H,21,22,23)/b12-6+ |
| InChIKey | INLJRVONCBTKDV-WUXMJOGZSA-N |
| XLogP | 4.79 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|