C19H19ClN6OS — CID 91240110
2-[3-chloro-4-(5-methyltetrazol-1-yl)phenyl]-3-cyclopentyl-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 91240110) has the molecular formula C19H19ClN6OS and a molecular weight of 414.92 g/mol. Its IUPAC name is 2-[3-chloro-4-(5-methyltetrazol-1-yl)phenyl]-3-cyclopentyl-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | 2-[3-chloro-4-(5-methyltetrazol-1-yl)phenyl]-3-cyclopentyl-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 91240110 |
| Molecular Formula | C19H19ClN6OS |
| Molecular Weight | 414.92 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 2-[3-chloro-4-(5-methyltetrazol-1-yl)phenyl]-3-cyclopentyl-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | Cc1nnnn1-c1ccc(C(=CC2CCCC2)C(=O)Nc2nccs2)cc1Cl |
| InChI | InChI=1S/C19H19ClN6OS/c1-12-23-24-25-26(12)17-7-6-14(11-16(17)20)15(10-13-4-2-3-5-13)18(27)22-19-21-8-9-28-19/h6-11,13H,2-5H2,1H3,(H,21,22,27) |
| InChIKey | VLMUMBDJCAPBLI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.92 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|