C18H18N6OS — CID 10067480
(E)-3-cyclopentyl-N-(1,3-thiazol-2-yl)-2-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]prop-2-enamide (PubChem CID 10067480) has the molecular formula C18H18N6OS and a molecular weight of 366.45 g/mol. Its IUPAC name is (E)-3-cyclopentyl-N-(1,3-thiazol-2-yl)-2-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]prop-2-enamide.
| Compound Name | (E)-3-cyclopentyl-N-(1,3-thiazol-2-yl)-2-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 10067480 |
| Molecular Formula | C18H18N6OS |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | (E)-3-cyclopentyl-N-(1,3-thiazol-2-yl)-2-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]prop-2-enamide |
| SMILES | O=C(Nc1nccs1)/C(=C/C1CCCC1)c1ccc(-n2cncn2)nc1 |
| InChI | InChI=1S/C18H18N6OS/c25-17(23-18-20-7-8-26-18)15(9-13-3-1-2-4-13)14-5-6-16(21-10-14)24-12-19-11-22-24/h5-13H,1-4H2,(H,20,23,25)/b15-9+ |
| InChIKey | NLLKTKOXGOLCDL-OQLLNIDSSA-N |
| XLogP | 3.33 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|