C17H17ClN4O3S — CID 173075918
[5-[3-[(5-chloro-1,3-thiazol-2-yl)amino]-1-cyclopentyl-3-oxoprop-1-en-2-yl]-2-pyridinyl]carbamic acid (PubChem CID 173075918) has the molecular formula C17H17ClN4O3S and a molecular weight of 392.87 g/mol. Its IUPAC name is [5-[3-[(5-chloro-1,3-thiazol-2-yl)amino]-1-cyclopentyl-3-oxoprop-1-en-2-yl]-2-pyridinyl]carbamic acid.
| Compound Name | [5-[3-[(5-chloro-1,3-thiazol-2-yl)amino]-1-cyclopentyl-3-oxoprop-1-en-2-yl]-2-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 173075918 |
| Molecular Formula | C17H17ClN4O3S |
| Molecular Weight | 392.87 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | [5-[3-[(5-chloro-1,3-thiazol-2-yl)amino]-1-cyclopentyl-3-oxoprop-1-en-2-yl]-2-pyridinyl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(C(=CC2CCCC2)C(=O)Nc2ncc(Cl)s2)cn1 |
| InChI | InChI=1S/C17H17ClN4O3S/c18-13-9-20-16(26-13)22-15(23)12(7-10-3-1-2-4-10)11-5-6-14(19-8-11)21-17(24)25/h5-10H,1-4H2,(H,19,21)(H,24,25)(H,20,22,23) |
| InChIKey | ZNZIIAPOXKXVGP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.87 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|