C21H23ClN6OS — CID 87417274
(E)-2-[3-chloro-4-(5-methyltetrazol-5-yl)phenyl]-3-cycloheptyl-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 87417274) has the molecular formula C21H23ClN6OS and a molecular weight of 442.98 g/mol. Its IUPAC name is (E)-2-[3-chloro-4-(5-methyltetrazol-5-yl)phenyl]-3-cycloheptyl-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-2-[3-chloro-4-(5-methyltetrazol-5-yl)phenyl]-3-cycloheptyl-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 87417274 |
| Molecular Formula | C21H23ClN6OS |
| Molecular Weight | 442.98 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | (E)-2-[3-chloro-4-(5-methyltetrazol-5-yl)phenyl]-3-cycloheptyl-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | CC1(c2ccc(/C(=C\C3CCCCCC3)C(=O)Nc3nccs3)cc2Cl)N=NN=N1 |
| InChI | InChI=1S/C21H23ClN6OS/c1-21(25-27-28-26-21)17-9-8-15(13-18(17)22)16(12-14-6-4-2-3-5-7-14)19(29)24-20-23-10-11-30-20/h8-14H,2-7H2,1H3,(H,23,24,29)/b16-12+ |
| InChIKey | ITWLIWIYXZILAL-FOWTUZBSSA-N |
| XLogP | 6.79 |
| TPSA | 91.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.98 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|