C18H19N3O3S — CID 51125247
1-[2-(4-methylphenyl)-2-oxoacetyl]-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide (PubChem CID 51125247) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is 1-[2-(4-methylphenyl)-2-oxoacetyl]-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide.
| Compound Name | 1-[2-(4-methylphenyl)-2-oxoacetyl]-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 51125247 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 1-[2-(4-methylphenyl)-2-oxoacetyl]-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)C(=O)N2CCCC(C(=O)Nc3nccs3)C2)cc1 |
| InChI | InChI=1S/C18H19N3O3S/c1-12-4-6-13(7-5-12)15(22)17(24)21-9-2-3-14(11-21)16(23)20-18-19-8-10-25-18/h4-8,10,14H,2-3,9,11H2,1H3,(H,19,20,23) |
| InChIKey | JSVQTCHWOIWHDS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|