C17H20N4O4S2 — CID 55812809
1-[4-(methylsulfamoyl)benzoyl]-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide (PubChem CID 55812809) has the molecular formula C17H20N4O4S2 and a molecular weight of 408.51 g/mol. Its IUPAC name is 1-[4-(methylsulfamoyl)benzoyl]-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide.
| Compound Name | 1-[4-(methylsulfamoyl)benzoyl]-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55812809 |
| Molecular Formula | C17H20N4O4S2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 1-[4-(methylsulfamoyl)benzoyl]-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)N2CCCC(C(=O)Nc3nccs3)C2)cc1 |
| InChI | InChI=1S/C17H20N4O4S2/c1-18-27(24,25)14-6-4-12(5-7-14)16(23)21-9-2-3-13(11-21)15(22)20-17-19-8-10-26-17/h4-8,10,13,18H,2-3,9,11H2,1H3,(H,19,20,22) |
| InChIKey | XOPYIHHDRBJYKJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |