C23H23N3O3S — CID 55960033
1-[4-(phenoxymethyl)benzoyl]-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide (PubChem CID 55960033) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is 1-[4-(phenoxymethyl)benzoyl]-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide.
| Compound Name | 1-[4-(phenoxymethyl)benzoyl]-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55960033 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 1-[4-(phenoxymethyl)benzoyl]-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1nccs1)C1CCCN(C(=O)c2ccc(COc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C23H23N3O3S/c27-21(25-23-24-12-14-30-23)19-5-4-13-26(15-19)22(28)18-10-8-17(9-11-18)16-29-20-6-2-1-3-7-20/h1-3,6-12,14,19H,4-5,13,15-16H2,(H,24,25,27) |
| InChIKey | PCFKWSIICBSRFF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |