C17H19N3O3S — CID 94132003
(3R)-1-(2-methoxybenzoyl)-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide (PubChem CID 94132003) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is (3R)-1-(2-methoxybenzoyl)-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(2-methoxybenzoyl)-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94132003 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | (3R)-1-(2-methoxybenzoyl)-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide |
| SMILES | COc1ccccc1C(=O)N1CCC[C@@H](C(=O)Nc2nccs2)C1 |
| InChI | InChI=1S/C17H19N3O3S/c1-23-14-7-3-2-6-13(14)16(22)20-9-4-5-12(11-20)15(21)19-17-18-8-10-24-17/h2-3,6-8,10,12H,4-5,9,11H2,1H3,(H,18,19,21)/t12-/m1/s1 |
| InChIKey | FNXDQSLHAGGTAT-GFCCVEGCSA-N |
| XLogP | 2.64 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |