C18H20Cl2N2OS — CID 142018521
3-cyclohexyl-2-(3,4-dichlorophenyl)-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 142018521) has the molecular formula C18H20Cl2N2OS and a molecular weight of 383.34 g/mol. Its IUPAC name is 3-cyclohexyl-2-(3,4-dichlorophenyl)-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-cyclohexyl-2-(3,4-dichlorophenyl)-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 142018521 |
| Molecular Formula | C18H20Cl2N2OS |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 3-cyclohexyl-2-(3,4-dichlorophenyl)-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | O=C(Nc1nccs1)C(CC1CCCCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H20Cl2N2OS/c19-15-7-6-13(11-16(15)20)14(10-12-4-2-1-3-5-12)17(23)22-18-21-8-9-24-18/h6-9,11-12,14H,1-5,10H2,(H,21,22,23) |
| InChIKey | ASCLXJCYBSKRHI-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |