C18H19Cl2N3O2S — CID 73082104
2-(3,4-dichlorophenyl)-3-(3-methoxyiminocyclopentyl)-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 73082104) has the molecular formula C18H19Cl2N3O2S and a molecular weight of 412.34 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-3-(3-methoxyiminocyclopentyl)-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 2-(3,4-dichlorophenyl)-3-(3-methoxyiminocyclopentyl)-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 73082104 |
| Molecular Formula | C18H19Cl2N3O2S |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-3-(3-methoxyiminocyclopentyl)-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | CON=C1CCC(CC(C(=O)Nc2nccs2)c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C18H19Cl2N3O2S/c1-25-23-13-4-2-11(8-13)9-14(12-3-5-15(19)16(20)10-12)17(24)22-18-21-6-7-26-18/h3,5-7,10-11,14H,2,4,8-9H2,1H3,(H,21,22,24) |
| InChIKey | MDGRKUBRJZTHCC-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|