C19H23N3OS — CID 157066316
3-cyclopentyl-2-(4-isocyanophenyl)-N-(1,3-thiazol-2-yl)propanamide;methane (PubChem CID 157066316) has the molecular formula C19H23N3OS and a molecular weight of 341.48 g/mol. Its IUPAC name is 3-cyclopentyl-2-(4-isocyanophenyl)-N-(1,3-thiazol-2-yl)propanamide;methane.
| Compound Name | 3-cyclopentyl-2-(4-isocyanophenyl)-N-(1,3-thiazol-2-yl)propanamide;methane |
|---|---|
| PubChem CID | 157066316 |
| Molecular Formula | C19H23N3OS |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 3-cyclopentyl-2-(4-isocyanophenyl)-N-(1,3-thiazol-2-yl)propanamide;methane |
| SMILES | C.[C-]#[N+]c1ccc(C(CC2CCCC2)C(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C18H19N3OS.CH4/c1-19-15-8-6-14(7-9-15)16(12-13-4-2-3-5-13)17(22)21-18-20-10-11-23-18;/h6-11,13,16H,2-5,12H2,(H,20,21,22);1H4 |
| InChIKey | ABXKENSSNRQYEQ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 46.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|