C21H28N2O3S2 — CID 22315127
2-(4-butylsulfonylphenyl)-3-cyclopentyl-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 22315127) has the molecular formula C21H28N2O3S2 and a molecular weight of 420.60 g/mol. Its IUPAC name is 2-(4-butylsulfonylphenyl)-3-cyclopentyl-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 2-(4-butylsulfonylphenyl)-3-cyclopentyl-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 22315127 |
| Molecular Formula | C21H28N2O3S2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 2-(4-butylsulfonylphenyl)-3-cyclopentyl-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | CCCCS(=O)(=O)c1ccc(C(CC2CCCC2)C(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C21H28N2O3S2/c1-2-3-14-28(25,26)18-10-8-17(9-11-18)19(15-16-6-4-5-7-16)20(24)23-21-22-12-13-27-21/h8-13,16,19H,2-7,14-15H2,1H3,(H,22,23,24) |
| InChIKey | UXZOVQCULCZFTI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |