C25H34N4O3S2 — CID 174556459
3-cyclopentyl-2-[4-[1-(4-methylpiperazin-1-yl)prop-2-enylsulfonyl]phenyl]-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 174556459) has the molecular formula C25H34N4O3S2 and a molecular weight of 502.71 g/mol. Its IUPAC name is 3-cyclopentyl-2-[4-[1-(4-methylpiperazin-1-yl)prop-2-enylsulfonyl]phenyl]-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-cyclopentyl-2-[4-[1-(4-methylpiperazin-1-yl)prop-2-enylsulfonyl]phenyl]-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 174556459 |
| Molecular Formula | C25H34N4O3S2 |
| Molecular Weight | 502.71 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 3-cyclopentyl-2-[4-[1-(4-methylpiperazin-1-yl)prop-2-enylsulfonyl]phenyl]-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | C=CC(N1CCN(C)CC1)S(=O)(=O)c1ccc(C(CC2CCCC2)C(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C25H34N4O3S2/c1-3-23(29-15-13-28(2)14-16-29)34(31,32)21-10-8-20(9-11-21)22(18-19-6-4-5-7-19)24(30)27-25-26-12-17-33-25/h3,8-12,17,19,22-23H,1,4-7,13-16,18H2,2H3,(H,26,27,30) |
| InChIKey | ZCFGRIRHBWIDIT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.71 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|