C23H28N2O2S — CID 10200796
3-cyclopentyl-2-[4-(3-hydroxy-3-methylpent-1-ynyl)phenyl]-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 10200796) has the molecular formula C23H28N2O2S and a molecular weight of 396.56 g/mol. Its IUPAC name is 3-cyclopentyl-2-[4-(3-hydroxy-3-methylpent-1-ynyl)phenyl]-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-cyclopentyl-2-[4-(3-hydroxy-3-methylpent-1-ynyl)phenyl]-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 10200796 |
| Molecular Formula | C23H28N2O2S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 3-cyclopentyl-2-[4-(3-hydroxy-3-methylpent-1-ynyl)phenyl]-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | CCC(C)(O)C#Cc1ccc(C(CC2CCCC2)C(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C23H28N2O2S/c1-3-23(2,27)13-12-17-8-10-19(11-9-17)20(16-18-6-4-5-7-18)21(26)25-22-24-14-15-28-22/h8-11,14-15,18,20,27H,3-7,16H2,1-2H3,(H,24,25,26) |
| InChIKey | MWRLZMKJPZXNEL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|