C18H22N3O4S2- — CID 174372789
[4-[3-cyclopentyl-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-2-(hydroxyamino)phenyl]methanesulfinate (PubChem CID 174372789) has the molecular formula C18H22N3O4S2- and a molecular weight of 408.53 g/mol. Its IUPAC name is [4-[3-cyclopentyl-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-2-(hydroxyamino)phenyl]methanesulfinate.
| Compound Name | [4-[3-cyclopentyl-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-2-(hydroxyamino)phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174372789 |
| Molecular Formula | C18H22N3O4S2- |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | [4-[3-cyclopentyl-1-oxo-1-(1,3-thiazol-2-ylamino)propan-2-yl]-2-(hydroxyamino)phenyl]methanesulfinate |
| SMILES | O=C(Nc1nccs1)C(CC1CCCC1)c1ccc(CS(=O)[O-])c(NO)c1 |
| InChI | InChI=1S/C18H23N3O4S2/c22-17(20-18-19-7-8-26-18)15(9-12-3-1-2-4-12)13-5-6-14(11-27(24)25)16(10-13)21-23/h5-8,10,12,15,21,23H,1-4,9,11H2,(H,24,25)(H,19,20,22)/p-1 |
| InChIKey | HGDBUOZIYCXXFV-UHFFFAOYSA-M |
| XLogP | 3.63 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|