C17H17Cl2N3O2S — CID 10408546
2-(3,4-dichlorophenyl)-3-[(3Z)-3-hydroxyiminocyclopentyl]-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 10408546) has the molecular formula C17H17Cl2N3O2S and a molecular weight of 398.32 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-3-[(3Z)-3-hydroxyiminocyclopentyl]-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 2-(3,4-dichlorophenyl)-3-[(3Z)-3-hydroxyiminocyclopentyl]-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 10408546 |
| Molecular Formula | C17H17Cl2N3O2S |
| Molecular Weight | 398.32 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-3-[(3Z)-3-hydroxyiminocyclopentyl]-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | O=C(Nc1nccs1)C(CC1CC/C(=N/O)C1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2N3O2S/c18-14-4-2-11(9-15(14)19)13(8-10-1-3-12(7-10)22-24)16(23)21-17-20-5-6-25-17/h2,4-6,9-10,13,24H,1,3,7-8H2,(H,20,21,23)/b22-12- |
| InChIKey | ZFOTWHZMUCAEPC-UUYOSTAYSA-N |
| XLogP | 5.19 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.32 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|