C19H22ClN3O2S2 — CID 85153860
2-(5-chloro-6-propylsulfinyl-3-pyridinyl)-3-cyclopentyl-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 85153860) has the molecular formula C19H22ClN3O2S2 and a molecular weight of 423.99 g/mol. Its IUPAC name is 2-(5-chloro-6-propylsulfinyl-3-pyridinyl)-3-cyclopentyl-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | 2-(5-chloro-6-propylsulfinyl-3-pyridinyl)-3-cyclopentyl-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 85153860 |
| Molecular Formula | C19H22ClN3O2S2 |
| Molecular Weight | 423.99 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 2-(5-chloro-6-propylsulfinyl-3-pyridinyl)-3-cyclopentyl-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | CCCS(=O)c1ncc(C(=CC2CCCC2)C(=O)Nc2nccs2)cc1Cl |
| InChI | InChI=1S/C19H22ClN3O2S2/c1-2-9-27(25)18-16(20)11-14(12-22-18)15(10-13-5-3-4-6-13)17(24)23-19-21-7-8-26-19/h7-8,10-13H,2-6,9H2,1H3,(H,21,23,24) |
| InChIKey | RMQSGXSLZCRUCA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.99 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|