C19H18N2OS2 — CID 10066738
(Z)-2-(1-benzothiophen-2-yl)-3-cyclopentyl-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 10066738) has the molecular formula C19H18N2OS2 and a molecular weight of 354.50 g/mol. Its IUPAC name is (Z)-2-(1-benzothiophen-2-yl)-3-cyclopentyl-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-(1-benzothiophen-2-yl)-3-cyclopentyl-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 10066738 |
| Molecular Formula | C19H18N2OS2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | (Z)-2-(1-benzothiophen-2-yl)-3-cyclopentyl-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | O=C(Nc1nccs1)/C(=C/C1CCCC1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C19H18N2OS2/c22-18(21-19-20-9-10-23-19)15(11-13-5-1-2-6-13)17-12-14-7-3-4-8-16(14)24-17/h3-4,7-13H,1-2,5-6H2,(H,20,21,22)/b15-11+ |
| InChIKey | BFQSSIKDSHDIJE-RVDMUPIBSA-N |
| XLogP | 5.57 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|