C20H22N2OS2 — CID 10090582
2-(1-benzothiophen-2-yl)-3-cyclohexyl-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 10090582) has the molecular formula C20H22N2OS2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 2-(1-benzothiophen-2-yl)-3-cyclohexyl-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 2-(1-benzothiophen-2-yl)-3-cyclohexyl-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 10090582 |
| Molecular Formula | C20H22N2OS2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-(1-benzothiophen-2-yl)-3-cyclohexyl-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | O=C(Nc1nccs1)C(CC1CCCCC1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C20H22N2OS2/c23-19(22-20-21-10-11-24-20)16(12-14-6-2-1-3-7-14)18-13-15-8-4-5-9-17(15)25-18/h4-5,8-11,13-14,16H,1-3,6-7,12H2,(H,21,22,23) |
| InChIKey | VQQOBHFKKPLCAY-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |