C24H23N3OS — CID 22465294
2-azabicyclo[3.1.0]hexa-1,3,5-triene;3-cyclopentyl-2-(2-ethynylphenyl)-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 22465294) has the molecular formula C24H23N3OS and a molecular weight of 401.54 g/mol. Its IUPAC name is 2-azabicyclo[3.1.0]hexa-1,3,5-triene;3-cyclopentyl-2-(2-ethynylphenyl)-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 2-azabicyclo[3.1.0]hexa-1,3,5-triene;3-cyclopentyl-2-(2-ethynylphenyl)-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 22465294 |
| Molecular Formula | C24H23N3OS |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 2-azabicyclo[3.1.0]hexa-1,3,5-triene;3-cyclopentyl-2-(2-ethynylphenyl)-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | C#Cc1ccccc1C(CC1CCCC1)C(=O)Nc1nccs1.c1cc2cc-2n1 |
| InChI | InChI=1S/C19H20N2OS.C5H3N/c1-2-15-9-5-6-10-16(15)17(13-14-7-3-4-8-14)18(22)21-19-20-11-12-23-19;1-2-6-5-3-4(1)5/h1,5-6,9-12,14,17H,3-4,7-8,13H2,(H,20,21,22);1-3H |
| InChIKey | CASLAFYCXGDWEN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|