C17H18BN3O3S2 — CID 87419485
CID 87419485 (PubChem CID 87419485) has the molecular formula C17H18BN3O3S2 and a molecular weight of 387.30 g/mol.
| Compound Name | CID 87419485 |
|---|---|
| PubChem CID | 87419485 |
| Molecular Formula | C17H18BN3O3S2 |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(NC(=O)/C(=C/C2CCCC2)c2ccc(S(C)(=O)=O)nc2)s1 |
| InChI | InChI=1S/C17H18BN3O3S2/c1-26(23,24)15-7-6-12(9-19-15)13(8-11-4-2-3-5-11)16(22)21-17-20-10-14(18)25-17/h6-11H,2-5H2,1H3,(H,20,21,22)/b13-8+ |
| InChIKey | TZDNGJXXVZZWOG-MDWZMJQESA-N |
| XLogP | 1.95 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|