C19H20FN3O3S2 — CID 85122297
3-cyclopentyl-2-(6-cyclopropylsulfonyl-3-pyridinyl)-N-(5-fluoro-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 85122297) has the molecular formula C19H20FN3O3S2 and a molecular weight of 421.52 g/mol. Its IUPAC name is 3-cyclopentyl-2-(6-cyclopropylsulfonyl-3-pyridinyl)-N-(5-fluoro-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | 3-cyclopentyl-2-(6-cyclopropylsulfonyl-3-pyridinyl)-N-(5-fluoro-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 85122297 |
| Molecular Formula | C19H20FN3O3S2 |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 3-cyclopentyl-2-(6-cyclopropylsulfonyl-3-pyridinyl)-N-(5-fluoro-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | O=C(Nc1ncc(F)s1)C(=CC1CCCC1)c1ccc(S(=O)(=O)C2CC2)nc1 |
| InChI | InChI=1S/C19H20FN3O3S2/c20-16-11-22-19(27-16)23-18(24)15(9-12-3-1-2-4-12)13-5-8-17(21-10-13)28(25,26)14-6-7-14/h5,8-12,14H,1-4,6-7H2,(H,22,23,24) |
| InChIKey | SZTWCAGERZSDLA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|