C20H22FN3O5S2 — CID 76630828
2-(4-cyclopropylsulfonylphenyl)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(4-hydroxycyclohexyl)oxyiminoacetamide (PubChem CID 76630828) has the molecular formula C20H22FN3O5S2 and a molecular weight of 467.54 g/mol. Its IUPAC name is 2-(4-cyclopropylsulfonylphenyl)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(4-hydroxycyclohexyl)oxyiminoacetamide.
| Compound Name | 2-(4-cyclopropylsulfonylphenyl)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(4-hydroxycyclohexyl)oxyiminoacetamide |
|---|---|
| PubChem CID | 76630828 |
| Molecular Formula | C20H22FN3O5S2 |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | 2-(4-cyclopropylsulfonylphenyl)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(4-hydroxycyclohexyl)oxyiminoacetamide |
| SMILES | O=C(Nc1ncc(F)s1)C(=NOC1CCC(O)CC1)c1ccc(S(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C20H22FN3O5S2/c21-17-11-22-20(30-17)23-19(26)18(24-29-14-5-3-13(25)4-6-14)12-1-7-15(8-2-12)31(27,28)16-9-10-16/h1-2,7-8,11,13-14,16,25H,3-6,9-10H2,(H,22,23,26) |
| InChIKey | WGEJQDVAYKUAJV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|