C24H29N3O6S3 — CID 76631248
ethyl 3-[[2-[[2-cyclopentyloxyimino-2-(4-cyclopropylsulfonylphenyl)acetyl]amino]-1,3-thiazol-5-yl]sulfanyl]propanoate (PubChem CID 76631248) has the molecular formula C24H29N3O6S3 and a molecular weight of 551.71 g/mol. Its IUPAC name is ethyl 3-[[2-[[2-cyclopentyloxyimino-2-(4-cyclopropylsulfonylphenyl)acetyl]amino]-1,3-thiazol-5-yl]sulfanyl]propanoate.
| Compound Name | ethyl 3-[[2-[[2-cyclopentyloxyimino-2-(4-cyclopropylsulfonylphenyl)acetyl]amino]-1,3-thiazol-5-yl]sulfanyl]propanoate |
|---|---|
| PubChem CID | 76631248 |
| Molecular Formula | C24H29N3O6S3 |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | ethyl 3-[[2-[[2-cyclopentyloxyimino-2-(4-cyclopropylsulfonylphenyl)acetyl]amino]-1,3-thiazol-5-yl]sulfanyl]propanoate |
| SMILES | CCOC(=O)CCSc1cnc(NC(=O)C(=NOC2CCCC2)c2ccc(S(=O)(=O)C3CC3)cc2)s1 |
| InChI | InChI=1S/C24H29N3O6S3/c1-2-32-20(28)13-14-34-21-15-25-24(35-21)26-23(29)22(27-33-17-5-3-4-6-17)16-7-9-18(10-8-16)36(30,31)19-11-12-19/h7-10,15,17,19H,2-6,11-14H2,1H3,(H,25,26,29) |
| InChIKey | HISNCUIGNKRZPT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 124.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|