C21H25N5O7S2 — CID 136660542
[[amino-[2-[[2-cyclopentyloxyimino-2-(4-methylsulfonylphenyl)acetyl]amino]-1,3-thiazol-5-yl]methylidene]amino] ethyl carbonate (PubChem CID 136660542) has the molecular formula C21H25N5O7S2 and a molecular weight of 523.59 g/mol. Its IUPAC name is [[amino-[2-[[2-cyclopentyloxyimino-2-(4-methylsulfonylphenyl)acetyl]amino]-1,3-thiazol-5-yl]methylidene]amino] ethyl carbonate.
| Compound Name | [[amino-[2-[[2-cyclopentyloxyimino-2-(4-methylsulfonylphenyl)acetyl]amino]-1,3-thiazol-5-yl]methylidene]amino] ethyl carbonate |
|---|---|
| PubChem CID | 136660542 |
| Molecular Formula | C21H25N5O7S2 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | [[amino-[2-[[2-cyclopentyloxyimino-2-(4-methylsulfonylphenyl)acetyl]amino]-1,3-thiazol-5-yl]methylidene]amino] ethyl carbonate |
| SMILES | CCOC(=O)ON=C(N)c1cnc(NC(=O)C(=NOC2CCCC2)c2ccc(S(C)(=O)=O)cc2)s1 |
| InChI | InChI=1S/C21H25N5O7S2/c1-3-31-21(28)33-26-18(22)16-12-23-20(34-16)24-19(27)17(25-32-14-6-4-5-7-14)13-8-10-15(11-9-13)35(2,29)30/h8-12,14H,3-7H2,1-2H3,(H2,22,26)(H,23,24,27) |
| InChIKey | JXZDHPRQFORAHS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 171.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|