C17H18FN5O6S2 — CID 91337791
2-[4-[(2-amino-2-oxoethyl)sulfamoyl]phenyl]-N-(5-fluoro-1,3-thiazol-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide (PubChem CID 91337791) has the molecular formula C17H18FN5O6S2 and a molecular weight of 471.49 g/mol. Its IUPAC name is 2-[4-[(2-amino-2-oxoethyl)sulfamoyl]phenyl]-N-(5-fluoro-1,3-thiazol-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide.
| Compound Name | 2-[4-[(2-amino-2-oxoethyl)sulfamoyl]phenyl]-N-(5-fluoro-1,3-thiazol-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
|---|---|
| PubChem CID | 91337791 |
| Molecular Formula | C17H18FN5O6S2 |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 2-[4-[(2-amino-2-oxoethyl)sulfamoyl]phenyl]-N-(5-fluoro-1,3-thiazol-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
| SMILES | NC(=O)CNS(=O)(=O)c1ccc(C(=NO[C@@H]2CCOC2)C(=O)Nc2ncc(F)s2)cc1 |
| InChI | InChI=1S/C17H18FN5O6S2/c18-13-7-20-17(30-13)22-16(25)15(23-29-11-5-6-28-9-11)10-1-3-12(4-2-10)31(26,27)21-8-14(19)24/h1-4,7,11,21H,5-6,8-9H2,(H2,19,24)(H,20,22,25)/t11-/m1/s1 |
| InChIKey | SOFPIGVYMIMWHB-LLVKDONJSA-N |
| XLogP | 0.19 |
| TPSA | 162.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|