C21H26N4O6S2 — CID 90913754
N-(5-methyl-1,3-thiazol-2-yl)-2-[4-[[(2R)-oxolan-2-yl]methylsulfamoyl]phenyl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide (PubChem CID 90913754) has the molecular formula C21H26N4O6S2 and a molecular weight of 494.60 g/mol. Its IUPAC name is N-(5-methyl-1,3-thiazol-2-yl)-2-[4-[[(2R)-oxolan-2-yl]methylsulfamoyl]phenyl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide.
| Compound Name | N-(5-methyl-1,3-thiazol-2-yl)-2-[4-[[(2R)-oxolan-2-yl]methylsulfamoyl]phenyl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
|---|---|
| PubChem CID | 90913754 |
| Molecular Formula | C21H26N4O6S2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | N-(5-methyl-1,3-thiazol-2-yl)-2-[4-[[(2R)-oxolan-2-yl]methylsulfamoyl]phenyl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
| SMILES | Cc1cnc(NC(=O)C(=NO[C@@H]2CCOC2)c2ccc(S(=O)(=O)NC[C@H]3CCCO3)cc2)s1 |
| InChI | InChI=1S/C21H26N4O6S2/c1-14-11-22-21(32-14)24-20(26)19(25-31-17-8-10-29-13-17)15-4-6-18(7-5-15)33(27,28)23-12-16-3-2-9-30-16/h4-7,11,16-17,23H,2-3,8-10,12-13H2,1H3,(H,22,24,26)/t16-,17-/m1/s1 |
| InChIKey | IDNZDOBJVRGCIB-IAGOWNOFSA-N |
| XLogP | 2.06 |
| TPSA | 128.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|