C18H21FN4O6S2 — CID 91239224
N-(5-fluoro-1,3-thiazol-2-yl)-2-[4-[[(2R)-1-hydroxypropan-2-yl]sulfamoyl]phenyl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide (PubChem CID 91239224) has the molecular formula C18H21FN4O6S2 and a molecular weight of 472.52 g/mol. Its IUPAC name is N-(5-fluoro-1,3-thiazol-2-yl)-2-[4-[[(2R)-1-hydroxypropan-2-yl]sulfamoyl]phenyl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide.
| Compound Name | N-(5-fluoro-1,3-thiazol-2-yl)-2-[4-[[(2R)-1-hydroxypropan-2-yl]sulfamoyl]phenyl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
|---|---|
| PubChem CID | 91239224 |
| Molecular Formula | C18H21FN4O6S2 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | N-(5-fluoro-1,3-thiazol-2-yl)-2-[4-[[(2R)-1-hydroxypropan-2-yl]sulfamoyl]phenyl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
| SMILES | C[C@H](CO)NS(=O)(=O)c1ccc(C(=NO[C@@H]2CCOC2)C(=O)Nc2ncc(F)s2)cc1 |
| InChI | InChI=1S/C18H21FN4O6S2/c1-11(9-24)23-31(26,27)14-4-2-12(3-5-14)16(22-29-13-6-7-28-10-13)17(25)21-18-20-8-15(19)30-18/h2-5,8,11,13,23-24H,6-7,9-10H2,1H3,(H,20,21,25)/t11-,13-/m1/s1 |
| InChIKey | KSYKSURIHMEDLV-DGCLKSJQSA-N |
| XLogP | 1.09 |
| TPSA | 139.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|