C19H19FN4O4S — CID 90867288
N-[4-[C-[(5-fluoro-1,3-thiazol-2-yl)carbamoyl]-N-[(3R)-oxolan-3-yl]oxycarbonimidoyl]phenyl]cyclopropanecarboxamide (PubChem CID 90867288) has the molecular formula C19H19FN4O4S and a molecular weight of 418.45 g/mol. Its IUPAC name is N-[4-[C-[(5-fluoro-1,3-thiazol-2-yl)carbamoyl]-N-[(3R)-oxolan-3-yl]oxycarbonimidoyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[C-[(5-fluoro-1,3-thiazol-2-yl)carbamoyl]-N-[(3R)-oxolan-3-yl]oxycarbonimidoyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 90867288 |
| Molecular Formula | C19H19FN4O4S |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | N-[4-[C-[(5-fluoro-1,3-thiazol-2-yl)carbamoyl]-N-[(3R)-oxolan-3-yl]oxycarbonimidoyl]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1ncc(F)s1)C(=NO[C@@H]1CCOC1)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C19H19FN4O4S/c20-15-9-21-19(29-15)23-18(26)16(24-28-14-7-8-27-10-14)11-3-5-13(6-4-11)22-17(25)12-1-2-12/h3-6,9,12,14H,1-2,7-8,10H2,(H,22,25)(H,21,23,26)/t14-/m1/s1 |
| InChIKey | BORUKISZHLECLC-CQSZACIVSA-N |
| XLogP | 2.78 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|