C19H20FN3O5S2 — CID 90984512
2-(4-cyclobutylsulfonylphenyl)-N-(5-fluoro-1,3-thiazol-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide (PubChem CID 90984512) has the molecular formula C19H20FN3O5S2 and a molecular weight of 453.52 g/mol. Its IUPAC name is 2-(4-cyclobutylsulfonylphenyl)-N-(5-fluoro-1,3-thiazol-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide.
| Compound Name | 2-(4-cyclobutylsulfonylphenyl)-N-(5-fluoro-1,3-thiazol-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
|---|---|
| PubChem CID | 90984512 |
| Molecular Formula | C19H20FN3O5S2 |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 2-(4-cyclobutylsulfonylphenyl)-N-(5-fluoro-1,3-thiazol-2-yl)-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
| SMILES | O=C(Nc1ncc(F)s1)C(=NO[C@@H]1CCOC1)c1ccc(S(=O)(=O)C2CCC2)cc1 |
| InChI | InChI=1S/C19H20FN3O5S2/c20-16-10-21-19(29-16)22-18(24)17(23-28-13-8-9-27-11-13)12-4-6-15(7-5-12)30(25,26)14-2-1-3-14/h4-7,10,13-14H,1-3,8-9,11H2,(H,21,22,24)/t13-/m1/s1 |
| InChIKey | GMKXQNVQOMATBZ-CYBMUJFWSA-N |
| XLogP | 2.76 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|