C20H24FN5O5S2 — CID 91215577
N-(5-fluoro-1,3-thiazol-2-yl)-2-[4-[(3R)-3-methylpiperazin-1-yl]sulfonylphenyl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide (PubChem CID 91215577) has the molecular formula C20H24FN5O5S2 and a molecular weight of 497.57 g/mol. Its IUPAC name is N-(5-fluoro-1,3-thiazol-2-yl)-2-[4-[(3R)-3-methylpiperazin-1-yl]sulfonylphenyl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide.
| Compound Name | N-(5-fluoro-1,3-thiazol-2-yl)-2-[4-[(3R)-3-methylpiperazin-1-yl]sulfonylphenyl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
|---|---|
| PubChem CID | 91215577 |
| Molecular Formula | C20H24FN5O5S2 |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | N-(5-fluoro-1,3-thiazol-2-yl)-2-[4-[(3R)-3-methylpiperazin-1-yl]sulfonylphenyl]-2-[(3R)-oxolan-3-yl]oxyiminoacetamide |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2ccc(C(=NO[C@@H]3CCOC3)C(=O)Nc3ncc(F)s3)cc2)CCN1 |
| InChI | InChI=1S/C20H24FN5O5S2/c1-13-11-26(8-7-22-13)33(28,29)16-4-2-14(3-5-16)18(25-31-15-6-9-30-12-15)19(27)24-20-23-10-17(21)32-20/h2-5,10,13,15,22H,6-9,11-12H2,1H3,(H,23,24,27)/t13-,15-/m1/s1 |
| InChIKey | FIRFHJISTPGORB-UKRRQHHQSA-N |
| XLogP | 1.41 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|