C28H36N4O7S2 — CID 76631364
2-cyclopentyloxyimino-2-(4-cyclopropylsulfonylphenyl)-N-[5-[[1-(2-methoxyacetyl)piperidin-4-yl]oxymethyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 76631364) has the molecular formula C28H36N4O7S2 and a molecular weight of 604.75 g/mol. Its IUPAC name is 2-cyclopentyloxyimino-2-(4-cyclopropylsulfonylphenyl)-N-[5-[[1-(2-methoxyacetyl)piperidin-4-yl]oxymethyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-cyclopentyloxyimino-2-(4-cyclopropylsulfonylphenyl)-N-[5-[[1-(2-methoxyacetyl)piperidin-4-yl]oxymethyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 76631364 |
| Molecular Formula | C28H36N4O7S2 |
| Molecular Weight | 604.75 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | 2-cyclopentyloxyimino-2-(4-cyclopropylsulfonylphenyl)-N-[5-[[1-(2-methoxyacetyl)piperidin-4-yl]oxymethyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | COCC(=O)N1CCC(OCc2cnc(NC(=O)C(=NOC3CCCC3)c3ccc(S(=O)(=O)C4CC4)cc3)s2)CC1 |
| InChI | InChI=1S/C28H36N4O7S2/c1-37-18-25(33)32-14-12-20(13-15-32)38-17-22-16-29-28(40-22)30-27(34)26(31-39-21-4-2-3-5-21)19-6-8-23(9-7-19)41(35,36)24-10-11-24/h6-9,16,20-21,24H,2-5,10-15,17-18H2,1H3,(H,29,30,34) |
| InChIKey | CUHYGWIAHPDMBV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 136.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.75 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|